Products 728908-03-0
CAS 728908-03-0 is the registry number for 2-Chloro-n-(3-chloro-4-methylphenyl)-2-phenylacetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-(3-chloro-4-methylphenyl)-2-phenylacetamide (CAS 728908-03-0) is a chemical compound with the molecular formula C15H13Cl2NO and a molecular weight of 294.2 g/mol. IUPAC name: 2-chloro-N-(3-chloro-4-methylphenyl)-2-phenylacetamide. InChIKey: WHCFRBNKSHSYEP-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2NO |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 2-chloro-N-(3-chloro-4-methylphenyl)-2-phenylacetamide |
| InChIKey | WHCFRBNKSHSYEP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C(C2=CC=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)