Products 1021033-45-3
CAS 1021033-45-3 is the registry number for 1-(2,4-difluorophenyl)-3-methylbutan-1-amine, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2,4-difluorophenyl)-3-methylbutan-1-amine (CAS 1021033-45-3) is a chemical compound with the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-3-methylbutan-1-amine. InChIKey: HUYRHRUCHQUNSZ-UHFFFAOYSA-N.
| Molecular formula | C11H15F2N |
|---|---|
| Molecular weight | 199.24 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-3-methylbutan-1-amine |
| InChIKey | HUYRHRUCHQUNSZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C1=C(C=C(C=C1)F)F)N |
Computed by PubChem (NCBI)