CAS 1021067-85-5 appears in our catalog under these names: 1-(2,4-Difluorophenyl)-2,2-dimethylpropan-1-amine, 95%, 1-(2,4-Difluorophenyl)-2,2-dimethylpropan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-(2,4-difluorophenyl)-2,2-dimethylpropan-1-amine (CAS 1021067-85-5) is a chemical compound with the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-2,2-dimethylpropan-1-amine. InChIKey: OJOBBVRPQDBLPE-UHFFFAOYSA-N.
| Molecular formula | C11H15F2N |
|---|---|
| Molecular weight | 199.24 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-2,2-dimethylpropan-1-amine |
| InChIKey | OJOBBVRPQDBLPE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=C(C=C(C=C1)F)F)N |
Computed by PubChem (NCBI)