CAS 1021243-39-9 is the registry number for 4-(2,6-Dimethylmorpholin-4-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-(2,6-dimethylmorpholin-4-yl)benzoic acid (CAS 1021243-39-9) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 4-(2,6-dimethylmorpholin-4-yl)benzoic acid. InChIKey: OTRDBTJTZUXOKP-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 4-(2,6-dimethylmorpholin-4-yl)benzoic acid |
| InChIKey | OTRDBTJTZUXOKP-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)