CAS 1142191-83-0 is the registry number for 6-Chloro-5-pivalamidopicolinic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-chloro-5-(2,2-dimethylpropanoylamino)pyridine-2-carboxylic acid (CAS 1142191-83-0) is a chemical compound with the molecular formula C11H13ClN2O3 and a molecular weight of 256.68 g/mol. IUPAC name: 6-chloro-5-(2,2-dimethylpropanoylamino)pyridine-2-carboxylic acid. InChIKey: LZPRASZVDWUTNR-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O3 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | 6-chloro-5-(2,2-dimethylpropanoylamino)pyridine-2-carboxylic acid |
| InChIKey | LZPRASZVDWUTNR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(N=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)