Products 1142191-83-0

CAS 1142191-83-0 is the registry number for 6-Chloro-5-pivalamidopicolinic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

6-chloro-5-(2,2-dimethylpropanoylamino)pyridine-2-carboxylic acid (CAS 1142191-83-0) is a chemical compound with the molecular formula C11H13ClN2O3 and a molecular weight of 256.68 g/mol. IUPAC name: 6-chloro-5-(2,2-dimethylpropanoylamino)pyridine-2-carboxylic acid. InChIKey: LZPRASZVDWUTNR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClN2O3
Molecular weight256.68 g/mol
IUPAC name6-chloro-5-(2,2-dimethylpropanoylamino)pyridine-2-carboxylic acid
InChIKeyLZPRASZVDWUTNR-UHFFFAOYSA-N
SMILESCC(C)(C)C(=O)NC1=C(N=C(C=C1)C(=O)O)Cl

Computed by PubChem (NCBI)