Products 346664-00-4
CAS 346664-00-4 is the registry number for 4-Chloro-n,n-diethyl-3-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-chloro-N,N-diethyl-3-nitrobenzamide (CAS 346664-00-4) is a chemical compound with the molecular formula C11H13ClN2O3 and a molecular weight of 256.68 g/mol. IUPAC name: 4-chloro-N,N-diethyl-3-nitrobenzamide. InChIKey: HWWLUMZDGRNXLU-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O3 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | 4-chloro-N,N-diethyl-3-nitrobenzamide |
| InChIKey | HWWLUMZDGRNXLU-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)