CAS 102137-46-2 appears in our catalog under these names: 4–(Pyridin–2–ylmethoxy)aniline, 4-(Pyridin-2-ylmethoxy)-phenylamine, 95%, 4-(Pyridin-2-ylmethoxy)aniline, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(pyridin-2-ylmethoxy)aniline (CAS 102137-46-2) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: 4-(pyridin-2-ylmethoxy)aniline. InChIKey: CGWMMQFGQVDRII-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 4-(pyridin-2-ylmethoxy)aniline |
| InChIKey | CGWMMQFGQVDRII-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)COC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)