CAS 102153-55-9 appears in our catalog under these names: 3,6-dibromonaphthalen-2-ol, 3,6-Dibromo-2-Naphthalenol. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-dibromonaphthalen-2-ol (CAS 102153-55-9) is a chemical compound with the molecular formula C10H6Br2O and a molecular weight of 301.96 g/mol. IUPAC name: 3,6-dibromonaphthalen-2-ol. InChIKey: ZHKGQBWOTYXLPJ-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O |
|---|---|
| Molecular weight | 301.96 g/mol |
| IUPAC name | 3,6-dibromonaphthalen-2-ol |
| InChIKey | ZHKGQBWOTYXLPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC(=C(C=C21)O)Br)Br |
Computed by PubChem (NCBI)