Products 30478-89-8
CAS 30478-89-8 appears in our catalog under these names: 1,3-dibromonaphthalen-2-ol, 1,3-Dibromo-2-naphthalenol. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dibromonaphthalen-2-ol (CAS 30478-89-8) is a chemical compound with the molecular formula C10H6Br2O and a molecular weight of 301.96 g/mol. IUPAC name: 1,3-dibromonaphthalen-2-ol. InChIKey: BPABLEVYTPZMOJ-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O |
|---|---|
| Molecular weight | 301.96 g/mol |
| IUPAC name | 1,3-dibromonaphthalen-2-ol |
| InChIKey | BPABLEVYTPZMOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2Br)O)Br |
Computed by PubChem (NCBI)