CAS 106750-88-3 is the registry number for 6,7-Dibromo-1,4-dihydro-1,4-epoxynaphthalene. Offered by: TRC. Available pack sizes: 100mg, 10mg.
4,5-dibromo-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (CAS 106750-88-3) is a chemical compound with the molecular formula C10H6Br2O and a molecular weight of 301.96 g/mol. IUPAC name: 4,5-dibromo-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene. InChIKey: HFEYIRLVIARHFU-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O |
|---|---|
| Molecular weight | 301.96 g/mol |
| IUPAC name | 4,5-dibromo-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| InChIKey | HFEYIRLVIARHFU-UHFFFAOYSA-N |
| SMILES | C1=CC2C3=CC(=C(C=C3C1O2)Br)Br |
Computed by PubChem (NCBI)