CAS 102154-20-1 is the registry number for 3-(2,4-Dichlorophenyl)oxolane-2,5-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(2,4-dichlorophenyl)oxolane-2,5-dione (CAS 102154-20-1) is a chemical compound with the molecular formula C10H6Cl2O3 and a molecular weight of 245.06 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)oxolane-2,5-dione. InChIKey: CLWZVLBRHGVATF-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2O3 |
|---|---|
| Molecular weight | 245.06 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)oxolane-2,5-dione |
| InChIKey | CLWZVLBRHGVATF-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)OC1=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)