Products 83823-07-8
CAS 83823-07-8 is the registry number for 6,8-Dichloro-2H-chromene-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6,8-dichloro-2H-chromene-3-carboxylic acid (CAS 83823-07-8) is a chemical compound with the molecular formula C10H6Cl2O3 and a molecular weight of 245.06 g/mol. IUPAC name: 6,8-dichloro-2H-chromene-3-carboxylic acid. InChIKey: UYWUAFUTOZDQED-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2O3 |
|---|---|
| Molecular weight | 245.06 g/mol |
| IUPAC name | 6,8-dichloro-2H-chromene-3-carboxylic acid |
| InChIKey | UYWUAFUTOZDQED-UHFFFAOYSA-N |
| SMILES | C1C(=CC2=C(O1)C(=CC(=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)