CAS 1511164-17-2 is the registry number for 2-(6,7-Dichlorobenzofuran-3-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(6,7-dichloro-1-benzofuran-3-yl)acetic acid (CAS 1511164-17-2) is a chemical compound with the molecular formula C10H6Cl2O3 and a molecular weight of 245.06 g/mol. IUPAC name: 2-(6,7-dichloro-1-benzofuran-3-yl)acetic acid. InChIKey: IPCDXAMYEQJHCQ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2O3 |
|---|---|
| Molecular weight | 245.06 g/mol |
| IUPAC name | 2-(6,7-dichloro-1-benzofuran-3-yl)acetic acid |
| InChIKey | IPCDXAMYEQJHCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=CO2)CC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)