Products 1022128-80-8
CAS 1022128-80-8 appears in our catalog under these names: 1-(3-Aminophenyl)piperazin-2-one, 95%, 1–(3–Aminophenyl)piperazin–2–one, 1-(3-Aminophenyl)piperazin-2-one. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
1-(3-aminophenyl)piperazin-2-one (CAS 1022128-80-8) is a chemical compound with the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. IUPAC name: 1-(3-aminophenyl)piperazin-2-one. InChIKey: PGUYPEBXXBSLCE-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 1-(3-aminophenyl)piperazin-2-one |
| InChIKey | PGUYPEBXXBSLCE-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)