CAS 1022128-96-6 appears in our catalog under these names: 2-Bromo-6-iodobenzoic acid, 95%, 2-Bromo-6-iodobenzoic acid, 98%, 2-Bromo-6-iodobenzoic acid, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g, 100g, 100mg.
2-bromo-6-iodobenzoic acid (CAS 1022128-96-6) is a chemical compound with the molecular formula C7H4BrIO2 and a molecular weight of 326.91 g/mol. IUPAC name: 2-bromo-6-iodobenzoic acid. InChIKey: PTQGEYMPMWQTDM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrIO2 |
|---|---|
| Molecular weight | 326.91 g/mol |
| IUPAC name | 2-bromo-6-iodobenzoic acid |
| InChIKey | PTQGEYMPMWQTDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)C(=O)O)Br |
Computed by PubChem (NCBI)