CAS 855198-37-7 appears in our catalog under these names: 2–Bromo–3–iodobenzoic acid, 2-Bromo-3-iodobenzoic acid 96%, 2-Bromo-3-iodobenzoic acid, 96%, 96%, 2-Bromo-3-iodobenzoic acid, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 25g.
2-bromo-3-iodobenzoic acid (CAS 855198-37-7) is a chemical compound with the molecular formula C7H4BrIO2 and a molecular weight of 326.91 g/mol. IUPAC name: 2-bromo-3-iodobenzoic acid. InChIKey: SLQSFNIMAOUADF-UHFFFAOYSA-N.
| Molecular formula | C7H4BrIO2 |
|---|---|
| Molecular weight | 326.91 g/mol |
| IUPAC name | 2-bromo-3-iodobenzoic acid |
| InChIKey | SLQSFNIMAOUADF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)Br)C(=O)O |
Computed by PubChem (NCBI)