CAS 1300118-10-8 appears in our catalog under these names: 5-Bromo-4-iodo-1,3-benzodioxole, 95%, 5-Bromo-4-iodobenzo(d)(1,3)dioxole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
5-bromo-4-iodo-1,3-benzodioxole (CAS 1300118-10-8) is a chemical compound with the molecular formula C7H4BrIO2 and a molecular weight of 326.91 g/mol. IUPAC name: 5-bromo-4-iodo-1,3-benzodioxole. InChIKey: MTIAJPVXZKADMH-UHFFFAOYSA-N.
| Molecular formula | C7H4BrIO2 |
|---|---|
| Molecular weight | 326.91 g/mol |
| IUPAC name | 5-bromo-4-iodo-1,3-benzodioxole |
| InChIKey | MTIAJPVXZKADMH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Br)I |
Computed by PubChem (NCBI)