Products 1022206-23-0
CAS 1022206-23-0 is the registry number for N-(5-chloro-2-hydroxyphenyl)(phenylcyclopentyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(5-chloro-2-hydroxyphenyl)-1-phenylcyclopentane-1-carboxamide (CAS 1022206-23-0) is a chemical compound with the molecular formula C18H18ClNO2 and a molecular weight of 315.8 g/mol. IUPAC name: N-(5-chloro-2-hydroxyphenyl)-1-phenylcyclopentane-1-carboxamide. InChIKey: AWQOZVAIWFBJEK-UHFFFAOYSA-N.
| Molecular formula | C18H18ClNO2 |
|---|---|
| Molecular weight | 315.8 g/mol |
| IUPAC name | N-(5-chloro-2-hydroxyphenyl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | AWQOZVAIWFBJEK-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=C(C=CC(=C3)Cl)O |
Computed by PubChem (NCBI)