CAS 1208889-22-8 appears in our catalog under these names: 4-{((furan-2-ylmethyl)amino)(phenyl)methyl}phenol hydrochloride, 95%, 4-{((Furan-2-ylmethyl)amino)(phenyl)methyl}phenol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-[(furan-2-ylmethylamino)-phenylmethyl]phenol;hydrochloride (CAS 1208889-22-8) is a chemical compound with the molecular formula C18H18ClNO2 and a molecular weight of 315.8 g/mol. IUPAC name: 4-[(furan-2-ylmethylamino)-phenylmethyl]phenol;hydrochloride. InChIKey: YPPXDHDHEPKLFC-UHFFFAOYSA-N.
| Molecular formula | C18H18ClNO2 |
|---|---|
| Molecular weight | 315.8 g/mol |
| IUPAC name | 4-[(furan-2-ylmethylamino)-phenylmethyl]phenol;hydrochloride |
| InChIKey | YPPXDHDHEPKLFC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)O)NCC3=CC=CO3.Cl |
Computed by PubChem (NCBI)