CAS 80896-74-8 appears in our catalog under these names: trans-1-Benzyl-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid, 98%, trans-1-Benzyl-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid, 98%, 98%, rel-1-Benzyl-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(3S,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid (CAS 80896-74-8) is a chemical compound with the molecular formula C18H18ClNO2 and a molecular weight of 315.8 g/mol. IUPAC name: (3S,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid. InChIKey: KFNFWUMLKQDFKI-DLBZAZTESA-N.
| Molecular formula | C18H18ClNO2 |
|---|---|
| Molecular weight | 315.8 g/mol |
| IUPAC name | (3S,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | KFNFWUMLKQDFKI-DLBZAZTESA-N |
| SMILES | C1[C@H]([C@@H](CN1CC2=CC=CC=C2)C(=O)O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)