Products 102222-55-9

CAS 102222-55-9 is the registry number for Ethyl 4-oxo-4-(2,3,4-trimethoxyphenyl)butanoate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-oxo-4-(2,3,4-trimethoxyphenyl)butanoate (CAS 102222-55-9) is a chemical compound with the molecular formula C15H20O6 and a molecular weight of 296.31 g/mol. IUPAC name: ethyl 4-oxo-4-(2,3,4-trimethoxyphenyl)butanoate. InChIKey: GFLCIOZBTDJFJV-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20O6
Molecular weight296.31 g/mol
IUPAC nameethyl 4-oxo-4-(2,3,4-trimethoxyphenyl)butanoate
InChIKeyGFLCIOZBTDJFJV-UHFFFAOYSA-N
SMILESCCOC(=O)CCC(=O)C1=C(C(=C(C=C1)OC)OC)OC

Computed by PubChem (NCBI)