CAS 1022401-68-8 is the registry number for 12-phenylspiro(1,2,3-trihydroquinazoline-2,3'-indane)-4,11-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2'-phenylspiro[1,3-dihydroquinazoline-2,3'-2H-indene]-1',4-dione (CAS 1022401-68-8) is a chemical compound with the molecular formula C22H16N2O2 and a molecular weight of 340.4 g/mol. IUPAC name: 2'-phenylspiro[1,3-dihydroquinazoline-2,3'-2H-indene]-1',4-dione. InChIKey: SRDUOCKZHGTVPM-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 2'-phenylspiro[1,3-dihydroquinazoline-2,3'-2H-indene]-1',4-dione |
| InChIKey | SRDUOCKZHGTVPM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(=O)C3=CC=CC=C3C24NC5=CC=CC=C5C(=O)N4 |
Computed by PubChem (NCBI)