Products 102244-39-3
CAS 102244-39-3 is the registry number for 4-{(Methyl(phenyl)amino)methyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-[(N-methylanilino)methyl]benzoic acid (CAS 102244-39-3) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 4-[(N-methylanilino)methyl]benzoic acid. InChIKey: FIDFJVMZSRHHJH-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 4-[(N-methylanilino)methyl]benzoic acid |
| InChIKey | FIDFJVMZSRHHJH-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=C(C=C1)C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)