Products 1022735-22-3
CAS 1022735-22-3 is the registry number for ((4-chloro-2-nitrophenyl)sulfonyl)indan-5-ylamine. Offered by: Biosynth. Available pack sizes: 250mg.
4-chloro-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzenesulfonamide (CAS 1022735-22-3) is a chemical compound with the molecular formula C15H13ClN2O4S and a molecular weight of 352.8 g/mol. IUPAC name: 4-chloro-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzenesulfonamide. InChIKey: LPCHIYRMRVGBFU-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O4S |
|---|---|
| Molecular weight | 352.8 g/mol |
| IUPAC name | 4-chloro-N-(2,3-dihydro-1H-inden-5-yl)-2-nitrobenzenesulfonamide |
| InChIKey | LPCHIYRMRVGBFU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)NS(=O)(=O)C3=C(C=C(C=C3)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)