CAS 1022895-93-7 is the registry number for Cilastatin Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (E)-7-chloro-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoate (CAS 1022895-93-7) is a chemical compound with the molecular formula C15H24ClNO3 and a molecular weight of 301.81 g/mol. IUPAC name: ethyl (E)-7-chloro-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoate. InChIKey: NMWDFGOLTYRZMD-OYGDSYQHSA-N.
| Molecular formula | C15H24ClNO3 |
|---|---|
| Molecular weight | 301.81 g/mol |
| IUPAC name | ethyl (E)-7-chloro-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoate |
| InChIKey | NMWDFGOLTYRZMD-OYGDSYQHSA-N |
| SMILES | CCOC(=O)/C(=C\CCCCCl)/NC(=O)[C@H]1CC1(C)C |
Computed by PubChem (NCBI)