CAS 670278-82-7 appears in our catalog under these names: N-Benzyl-o-t-butyl-l-serine methyl ester hydrochloride, 95%, Bzl-L-Ser(tBu)-OMe*HCl. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 250mg, 5g, 1g.
Methyl (2S)-2-(benzylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride (CAS 670278-82-7) is a chemical compound with the molecular formula C15H24ClNO3 and a molecular weight of 301.81 g/mol. IUPAC name: methyl (2S)-2-(benzylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride. InChIKey: ANYVZGGUHIDNDZ-ZOWNYOTGSA-N.
| Molecular formula | C15H24ClNO3 |
|---|---|
| Molecular weight | 301.81 g/mol |
| IUPAC name | methyl (2S)-2-(benzylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride |
| InChIKey | ANYVZGGUHIDNDZ-ZOWNYOTGSA-N |
| SMILES | CC(C)(C)OC[C@@H](C(=O)OC)NCC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)