Products 1189649-47-5
CAS 1189649-47-5 appears in our catalog under these names: Oxprenolol-d7 Hydrochloride, >95% (HPLC), Oxprenolol hydrochloride-d7, Oxprenolol–d7 hydrochloride, Oxprenolol-d7 (hydrochloride), 98.25%. Offered by: TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 10 mg, 5 mg, 1 mg.
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-(2-prop-2-enoxyphenoxy)propan-2-ol;hydrochloride (CAS 1189649-47-5) is a chemical compound with the molecular formula C15H24ClNO3 and a molecular weight of 308.85 g/mol. IUPAC name: 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-(2-prop-2-enoxyphenoxy)propan-2-ol;hydrochloride. InChIKey: COAJXCLTPGGDAJ-CXUOUXNTSA-N.
| Molecular formula | C15H24ClNO3 |
|---|---|
| Molecular weight | 308.85 g/mol |
| IUPAC name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-(2-prop-2-enoxyphenoxy)propan-2-ol;hydrochloride |
| InChIKey | COAJXCLTPGGDAJ-CXUOUXNTSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=CC=C1OCC=C)O.Cl |
Computed by PubChem (NCBI)