CAS 1022922-17-3 appears in our catalog under these names: 5-Acetyl-2-chlorophenylboronic acid, 96%, 5–Acetyl–2–chlorophenylboronic acid(contains varying amounts of Anhydride), (5-Acetyl-2-chlorophenyl)boronic acid 95%, 5-Acetyl-2-chlorophenylboronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100mg.
(5-acetyl-2-chlorophenyl)boronic acid (CAS 1022922-17-3) is a chemical compound with the molecular formula C8H8BClO3 and a molecular weight of 198.41 g/mol. IUPAC name: (5-acetyl-2-chlorophenyl)boronic acid. InChIKey: QMHQVMHOGNFKMA-UHFFFAOYSA-N.
| Molecular formula | C8H8BClO3 |
|---|---|
| Molecular weight | 198.41 g/mol |
| IUPAC name | (5-acetyl-2-chlorophenyl)boronic acid |
| InChIKey | QMHQVMHOGNFKMA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)C)Cl)(O)O |
Computed by PubChem (NCBI)