Products 2377714-00-4

CAS 2377714-00-4 is the registry number for 3-Chloro-2-formyl-6-methylphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(3-chloro-2-formyl-6-methylphenyl)boronic acid (CAS 2377714-00-4) is a chemical compound with the molecular formula C8H8BClO3 and a molecular weight of 198.41 g/mol. IUPAC name: (3-chloro-2-formyl-6-methylphenyl)boronic acid. InChIKey: QZGOIICJSBDSJY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BClO3
Molecular weight198.41 g/mol
IUPAC name(3-chloro-2-formyl-6-methylphenyl)boronic acid
InChIKeyQZGOIICJSBDSJY-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1C=O)Cl)C)(O)O

Computed by PubChem (NCBI)