Products 2377606-50-1
CAS 2377606-50-1 appears in our catalog under these names: 3-Acetyl-4-chlorophenylboronic acid, 98%, (3-Acetyl-4-chlorophenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g.
(3-acetyl-4-chlorophenyl)boronic acid (CAS 2377606-50-1) is a chemical compound with the molecular formula C8H8BClO3 and a molecular weight of 198.41 g/mol. IUPAC name: (3-acetyl-4-chlorophenyl)boronic acid. InChIKey: IGOLVESNJWNACO-UHFFFAOYSA-N.
| Molecular formula | C8H8BClO3 |
|---|---|
| Molecular weight | 198.41 g/mol |
| IUPAC name | (3-acetyl-4-chlorophenyl)boronic acid |
| InChIKey | IGOLVESNJWNACO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)C)(O)O |
Computed by PubChem (NCBI)