CAS 1023441-52-2 is the registry number for 1-phenyl-N-(1,2,3-thiadiazol-4-yl)cyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
1-phenyl-N-(thiadiazol-4-yl)cyclopentane-1-carboxamide (CAS 1023441-52-2) is a chemical compound with the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. IUPAC name: 1-phenyl-N-(thiadiazol-4-yl)cyclopentane-1-carboxamide. InChIKey: KBHBWDWJIDWVRP-UHFFFAOYSA-N.
| Molecular formula | C14H15N3OS |
|---|---|
| Molecular weight | 273.36 g/mol |
| IUPAC name | 1-phenyl-N-(thiadiazol-4-yl)cyclopentane-1-carboxamide |
| InChIKey | KBHBWDWJIDWVRP-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=CSN=N3 |
Computed by PubChem (NCBI)