Products 1024480-42-9
CAS 1024480-42-9 is the registry number for 1-Benzothiazol-2-yl-3-(tert-butyl)-2-pyrazolin-5-one. Offered by: Biosynth. Available pack sizes: 5000mg.
2-(1,3-benzothiazol-2-yl)-5-tert-butyl-4H-pyrazol-3-one (CAS 1024480-42-9) is a chemical compound with the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-5-tert-butyl-4H-pyrazol-3-one. InChIKey: YWCYQGJDKLVKNW-UHFFFAOYSA-N.
| Molecular formula | C14H15N3OS |
|---|---|
| Molecular weight | 273.36 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-5-tert-butyl-4H-pyrazol-3-one |
| InChIKey | YWCYQGJDKLVKNW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=O)C1)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)