CAS 1225698-52-1 is the registry number for 5-(2-Aminothiazol-4-yl)-1,3,3-trimethylindolin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-amino-1,3-thiazol-4-yl)-1,3,3-trimethylindol-2-one (CAS 1225698-52-1) is a chemical compound with the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. IUPAC name: 5-(2-amino-1,3-thiazol-4-yl)-1,3,3-trimethylindol-2-one. InChIKey: ADTHWMGWQCNOLZ-UHFFFAOYSA-N.
| Molecular formula | C14H15N3OS |
|---|---|
| Molecular weight | 273.36 g/mol |
| IUPAC name | 5-(2-amino-1,3-thiazol-4-yl)-1,3,3-trimethylindol-2-one |
| InChIKey | ADTHWMGWQCNOLZ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)C3=CSC(=N3)N)N(C1=O)C)C |
Computed by PubChem (NCBI)