CAS 1023518-67-3 is the registry number for (2-chloro(3-pyridyl))-N-((3-(trifluoromethoxy)phenyl)methyl)formamide. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
2-chloro-N-[[3-(trifluoromethoxy)phenyl]methyl]pyridine-3-carboxamide (CAS 1023518-67-3) is a chemical compound with the molecular formula C14H10ClF3N2O2 and a molecular weight of 330.69 g/mol. IUPAC name: 2-chloro-N-[[3-(trifluoromethoxy)phenyl]methyl]pyridine-3-carboxamide. InChIKey: RXRLYRNUXCEHPU-UHFFFAOYSA-N.
| Molecular formula | C14H10ClF3N2O2 |
|---|---|
| Molecular weight | 330.69 g/mol |
| IUPAC name | 2-chloro-N-[[3-(trifluoromethoxy)phenyl]methyl]pyridine-3-carboxamide |
| InChIKey | RXRLYRNUXCEHPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)CNC(=O)C2=C(N=CC=C2)Cl |
Computed by PubChem (NCBI)