CAS 1023526-82-0 is the registry number for N-(3-bromo-2,4,6-trimethylphenyl)(phenylcyclopentyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(3-bromo-2,4,6-trimethylphenyl)-1-phenylcyclopentane-1-carboxamide (CAS 1023526-82-0) is a chemical compound with the molecular formula C21H24BrNO and a molecular weight of 386.3 g/mol. IUPAC name: N-(3-bromo-2,4,6-trimethylphenyl)-1-phenylcyclopentane-1-carboxamide. InChIKey: UEVMQSWRZWXWQD-UHFFFAOYSA-N.
| Molecular formula | C21H24BrNO |
|---|---|
| Molecular weight | 386.3 g/mol |
| IUPAC name | N-(3-bromo-2,4,6-trimethylphenyl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | UEVMQSWRZWXWQD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1NC(=O)C2(CCCC2)C3=CC=CC=C3)C)Br)C |
Computed by PubChem (NCBI)