Products 99083-11-1
CAS 99083-11-1 is the registry number for BTG 502. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E,4E)-6-(5-bromonaphthalen-2-yl)-N-(3-methylbutan-2-yl)hexa-2,4-dienamide (CAS 99083-11-1) is a chemical compound with the molecular formula C21H24BrNO and a molecular weight of 386.3 g/mol. IUPAC name: (2E,4E)-6-(5-bromonaphthalen-2-yl)-N-(3-methylbutan-2-yl)hexa-2,4-dienamide. InChIKey: FVMPXCCSVGCCRV-LJIKRCSCSA-N.
| Molecular formula | C21H24BrNO |
|---|---|
| Molecular weight | 386.3 g/mol |
| IUPAC name | (2E,4E)-6-(5-bromonaphthalen-2-yl)-N-(3-methylbutan-2-yl)hexa-2,4-dienamide |
| InChIKey | FVMPXCCSVGCCRV-LJIKRCSCSA-N |
| SMILES | CC(C)C(C)NC(=O)/C=C/C=C/CC1=CC2=C(C=C1)C(=CC=C2)Br |
Computed by PubChem (NCBI)