CAS 910466-47-6 is the registry number for 2-(4-bromophenyl)-5,7-di-tert-butylbenzo[d]oxazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-bromophenyl)-5,7-ditert-butyl-1,3-benzoxazole (CAS 910466-47-6) is a chemical compound with the molecular formula C21H24BrNO and a molecular weight of 386.3 g/mol. IUPAC name: 2-(4-bromophenyl)-5,7-ditert-butyl-1,3-benzoxazole. InChIKey: RBBWQZGZUZUQEP-UHFFFAOYSA-N.
| Molecular formula | C21H24BrNO |
|---|---|
| Molecular weight | 386.3 g/mol |
| IUPAC name | 2-(4-bromophenyl)-5,7-ditert-butyl-1,3-benzoxazole |
| InChIKey | RBBWQZGZUZUQEP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C2C(=C1)N=C(O2)C3=CC=C(C=C3)Br)C(C)(C)C |
Computed by PubChem (NCBI)