CAS 1023539-61-8 is the registry number for 2-bromo-3-(phenylamino)inden-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-anilino-2-bromoinden-1-one (CAS 1023539-61-8) is a chemical compound with the molecular formula C15H10BrNO and a molecular weight of 300.15 g/mol. IUPAC name: 3-anilino-2-bromoinden-1-one. InChIKey: GUWSGIDEQKXYNL-UHFFFAOYSA-N.
| Molecular formula | C15H10BrNO |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | 3-anilino-2-bromoinden-1-one |
| InChIKey | GUWSGIDEQKXYNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C(=O)C3=CC=CC=C32)Br |
Computed by PubChem (NCBI)