CAS 112182-51-1 appears in our catalog under these names: 6-Bromo-2-phenyl-1,4-dihydroquinolin-4-one, 95%, 6-Bromo-2-phenyl-1,4-dihydroquinolin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
6-bromo-2-phenyl-1H-quinolin-4-one (CAS 112182-51-1) is a chemical compound with the molecular formula C15H10BrNO and a molecular weight of 300.15 g/mol. IUPAC name: 6-bromo-2-phenyl-1H-quinolin-4-one. InChIKey: VJUYMVFNCPTYSH-UHFFFAOYSA-N.
| Molecular formula | C15H10BrNO |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | 6-bromo-2-phenyl-1H-quinolin-4-one |
| InChIKey | VJUYMVFNCPTYSH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(N2)C=CC(=C3)Br |
Computed by PubChem (NCBI)