CAS 1197391-19-7 appears in our catalog under these names: 4-Bromo-2-phenylquinolin-3-ol, 95%, 4-Bromo-2-phenylquinolin-3-ol, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 25mg.
4-bromo-2-phenylquinolin-3-ol (CAS 1197391-19-7) is a chemical compound with the molecular formula C15H10BrNO and a molecular weight of 300.15 g/mol. IUPAC name: 4-bromo-2-phenylquinolin-3-ol. InChIKey: OOZPGKLZYWHFQZ-UHFFFAOYSA-N.
| Molecular formula | C15H10BrNO |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | 4-bromo-2-phenylquinolin-3-ol |
| InChIKey | OOZPGKLZYWHFQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2O)Br |
Computed by PubChem (NCBI)