Products 1023649-53-7
CAS 1023649-53-7 appears in our catalog under these names: 4-Hydrazinyl-2-(trifluoromethyl)benzonitrile hydrochloride, 98%, 98%, 4-HYDRAZINYL-2-(TRIFLUOROMETHYL)BENZONITRILE HCL. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-hydrazinyl-2-(trifluoromethyl)benzonitrile;hydrochloride (CAS 1023649-53-7) is a chemical compound with the molecular formula C8H7ClF3N3 and a molecular weight of 237.61 g/mol. IUPAC name: 4-hydrazinyl-2-(trifluoromethyl)benzonitrile;hydrochloride. InChIKey: KXXSNUJUQCGZSS-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N3 |
|---|---|
| Molecular weight | 237.61 g/mol |
| IUPAC name | 4-hydrazinyl-2-(trifluoromethyl)benzonitrile;hydrochloride |
| InChIKey | KXXSNUJUQCGZSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NN)C(F)(F)F)C#N.Cl |
Computed by PubChem (NCBI)