CAS 2792167-64-5 is the registry number for 7-(Trifluoromethyl)-1H-benzo[d]imidazol-5-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(trifluoromethyl)-3H-benzimidazol-5-amine;hydrochloride (CAS 2792167-64-5) is a chemical compound with the molecular formula C8H7ClF3N3 and a molecular weight of 237.61 g/mol. IUPAC name: 7-(trifluoromethyl)-3H-benzimidazol-5-amine;hydrochloride. InChIKey: HAUJSDHMFZXXPF-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N3 |
|---|---|
| Molecular weight | 237.61 g/mol |
| IUPAC name | 7-(trifluoromethyl)-3H-benzimidazol-5-amine;hydrochloride |
| InChIKey | HAUJSDHMFZXXPF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1C(F)(F)F)N=CN2)N.Cl |
Computed by PubChem (NCBI)