CAS 1423033-54-8 appears in our catalog under these names: 5-(Trifluoromethyl)-1h-1,3-benzodiazol-2-amine hydrochloride, 95%, 5-(Trifluoromethyl)-1H-1,3-benzodiazol-2-amine hydrochloride, 5-(Trifluoromethyl)-1H-benzo[d]imidazol-2-amine hydrochloride, 95%, 95%, 6-(trifluoromethyl)-1H-1,3-benzodiazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
6-(trifluoromethyl)-1H-benzimidazol-2-amine;hydrochloride (CAS 1423033-54-8) is a chemical compound with the molecular formula C8H7ClF3N3 and a molecular weight of 237.61 g/mol. IUPAC name: 6-(trifluoromethyl)-1H-benzimidazol-2-amine;hydrochloride. InChIKey: PTJJIMFXQHLHNJ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N3 |
|---|---|
| Molecular weight | 237.61 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1H-benzimidazol-2-amine;hydrochloride |
| InChIKey | PTJJIMFXQHLHNJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)NC(=N2)N.Cl |
Computed by PubChem (NCBI)