CAS 1023817-05-1 appears in our catalog under these names: 2-(Trifluoromethyl)pyrimidine-4,5-diamine, 97%, 2-(Trifluoromethyl)pyrimidine-4,5-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(trifluoromethyl)pyrimidine-4,5-diamine (CAS 1023817-05-1) is a chemical compound with the molecular formula C5H5F3N4 and a molecular weight of 178.12 g/mol. IUPAC name: 2-(trifluoromethyl)pyrimidine-4,5-diamine. InChIKey: JIMAHMXSFTXDGJ-UHFFFAOYSA-N.
| Molecular formula | C5H5F3N4 |
|---|---|
| Molecular weight | 178.12 g/mol |
| IUPAC name | 2-(trifluoromethyl)pyrimidine-4,5-diamine |
| InChIKey | JIMAHMXSFTXDGJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)C(F)(F)F)N)N |
Computed by PubChem (NCBI)