CAS 672-46-8 appears in our catalog under these names: 2–(Trifluoromethyl)pyrimidine–4,6–diamine, 4,6-Diamino-2-trifluoromethylpyrimidine, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-(trifluoromethyl)pyrimidine-4,6-diamine (CAS 672-46-8) is a chemical compound with the molecular formula C5H5F3N4 and a molecular weight of 178.12 g/mol. IUPAC name: 2-(trifluoromethyl)pyrimidine-4,6-diamine. InChIKey: MEHAREFZRGNRJP-UHFFFAOYSA-N.
| Molecular formula | C5H5F3N4 |
|---|---|
| Molecular weight | 178.12 g/mol |
| IUPAC name | 2-(trifluoromethyl)pyrimidine-4,6-diamine |
| InChIKey | MEHAREFZRGNRJP-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N=C1N)C(F)(F)F)N |
Computed by PubChem (NCBI)