CAS 1131567-98-0 is the registry number for 2-Hydrazinyl-5-(trifluoromethyl)pyrimidine. Offered by: TRC. Available pack sizes: 1g.
[5-(trifluoromethyl)pyrimidin-2-yl]hydrazine (CAS 1131567-98-0) is a chemical compound with the molecular formula C5H5F3N4 and a molecular weight of 178.12 g/mol. IUPAC name: [5-(trifluoromethyl)pyrimidin-2-yl]hydrazine. InChIKey: FCEDZRGBKSZJOZ-UHFFFAOYSA-N.
| Molecular formula | C5H5F3N4 |
|---|---|
| Molecular weight | 178.12 g/mol |
| IUPAC name | [5-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
| InChIKey | FCEDZRGBKSZJOZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)NN)C(F)(F)F |
Computed by PubChem (NCBI)