Products 1023817-50-6
CAS 1023817-50-6 is the registry number for Diisopropyl 2-oxaspiro[3.3]heptane-6,6-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dipropan-2-yl 2-oxaspiro[3.3]heptane-6,6-dicarboxylate (CAS 1023817-50-6) is a chemical compound with the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. IUPAC name: dipropan-2-yl 2-oxaspiro[3.3]heptane-6,6-dicarboxylate. InChIKey: SBZAGERPZYUHPH-UHFFFAOYSA-N.
| Molecular formula | C14H22O5 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | dipropan-2-yl 2-oxaspiro[3.3]heptane-6,6-dicarboxylate |
| InChIKey | SBZAGERPZYUHPH-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1(CC2(C1)COC2)C(=O)OC(C)C |
Computed by PubChem (NCBI)