Products 1839080-28-2
CAS 1839080-28-2 is the registry number for (11R)-7,8-Dimethoxy-3,3,11-trimethyl-1,5-dioxaspiro(5.5)undec-7-en-9-one. Offered by: TRC. Available pack sizes: 100mg.
(7R)-10,11-dimethoxy-3,3,7-trimethyl-1,5-dioxaspiro[5.5]undec-10-en-9-one (CAS 1839080-28-2) is a chemical compound with the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. IUPAC name: (7R)-10,11-dimethoxy-3,3,7-trimethyl-1,5-dioxaspiro[5.5]undec-10-en-9-one. InChIKey: SGBJOBKGGBYLMN-SECBINFHSA-N.
| Molecular formula | C14H22O5 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | (7R)-10,11-dimethoxy-3,3,7-trimethyl-1,5-dioxaspiro[5.5]undec-10-en-9-one |
| InChIKey | SGBJOBKGGBYLMN-SECBINFHSA-N |
| SMILES | C[C@@H]1CC(=O)C(=C(C12OCC(CO2)(C)C)OC)OC |
Computed by PubChem (NCBI)