CAS 943515-58-0 appears in our catalog under these names: Oseltamivir Impurity 81, Oseltamivir Impurity 57, Ethyl (3aR,7R,7aS)-2,2-diethyl-7-hydroxy-3a,6,7,7a-tetrahydrobenzo[d][1,3]dioxole-5-carboxylate, 98%, Oseltamivir Impurity 87, 3,4-O-(Diethylmethylidene) Shikimic Acid Ethyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5g, 250mg.
Ethyl (3aR,7R,7aS)-2,2-diethyl-7-hydroxy-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (CAS 943515-58-0) is a chemical compound with the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. IUPAC name: ethyl (3aR,7R,7aS)-2,2-diethyl-7-hydroxy-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate. InChIKey: UPBCFJGUCHGYAN-UTUOFQBUSA-N.
| Molecular formula | C14H22O5 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | ethyl (3aR,7R,7aS)-2,2-diethyl-7-hydroxy-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| InChIKey | UPBCFJGUCHGYAN-UTUOFQBUSA-N |
| SMILES | CCC1(O[C@@H]2C=C(C[C@H]([C@@H]2O1)O)C(=O)OCC)CC |
Computed by PubChem (NCBI)