CAS 1023875-76-4 is the registry number for 4-chloro-2-nitro-N-(2-phenylethyl)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-chloro-2-nitro-N-(2-phenylethyl)benzenesulfonamide (CAS 1023875-76-4) is a chemical compound with the molecular formula C14H13ClN2O4S and a molecular weight of 340.8 g/mol. IUPAC name: 4-chloro-2-nitro-N-(2-phenylethyl)benzenesulfonamide. InChIKey: YFXPMWNEZSIYDW-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O4S |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | 4-chloro-2-nitro-N-(2-phenylethyl)benzenesulfonamide |
| InChIKey | YFXPMWNEZSIYDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNS(=O)(=O)C2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)